C20H18N4O3 — CID 91045952
N-[5-[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]prop-2-enamide (PubChem CID 91045952) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-[5-[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]prop-2-enamide.
| Compound Name | N-[5-[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 91045952 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[5-[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1nc2cccc(C3=COC=C(CC4=CC=CCC4)O3)n2n1 |
| InChI | InChI=1S/C20H18N4O3/c1-2-19(25)22-20-21-18-10-6-9-16(24(18)23-20)17-13-26-12-15(27-17)11-14-7-4-3-5-8-14/h2-4,6-7,9-10,12-13H,1,5,8,11H2,(H,22,23,25) |
| InChIKey | IVPNECZAQJBEQJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|