C23H25N5O2 — CID 91046036
6-[4-(2-ethyltetrazol-5-yl)phenyl]-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol (PubChem CID 91046036) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 6-[4-(2-ethyltetrazol-5-yl)phenyl]-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol.
| Compound Name | 6-[4-(2-ethyltetrazol-5-yl)phenyl]-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
|---|---|
| PubChem CID | 91046036 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 6-[4-(2-ethyltetrazol-5-yl)phenyl]-8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-ol |
| SMILES | CCn1nnc(-c2ccc(C3=NC4CCC(O)CC4c4ccc(OC)cc43)cc2)n1 |
| InChI | InChI=1S/C23H25N5O2/c1-3-28-26-23(25-27-28)15-6-4-14(5-7-15)22-20-13-17(30-2)9-10-18(20)19-12-16(29)8-11-21(19)24-22/h4-7,9-10,13,16,19,21,29H,3,8,11-12H2,1-2H3 |
| InChIKey | HTGGXZTYHSNJNB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |