C5H10N4O3 — CID 91046319
(2R,3R,4R)-4-azido-2-(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 91046319) has the molecular formula C5H10N4O3 and a molecular weight of 174.16 g/mol. Its IUPAC name is (2R,3R,4R)-4-azido-2-(hydroxymethyl)pyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4R)-4-azido-2-(hydroxymethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 91046319 |
| Molecular Formula | C5H10N4O3 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (2R,3R,4R)-4-azido-2-(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | [N-]=[N+]=N[C@@]1(O)CN[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C5H10N4O3/c6-9-8-5(12)2-7-3(1-10)4(5)11/h3-4,7,10-12H,1-2H2/t3-,4-,5-/m1/s1 |
| InChIKey | ZQDZGJVGOFDWJT-UOWFLXDJSA-N |
| XLogP | -1.69 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|