C27H37Br2N — CID 91046352
2-bromo-8-[2-(4-bromo-2-methyl-1H-inden-1-yl)propan-2-yl]-5,7-dimethyl-2,3,4,4a,5,5a,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[g]quinoline (PubChem CID 91046352) has the molecular formula C27H37Br2N and a molecular weight of 535.41 g/mol. Its IUPAC name is 2-bromo-8-[2-(4-bromo-2-methyl-1H-inden-1-yl)propan-2-yl]-5,7-dimethyl-2,3,4,4a,5,5a,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[g]quinoline.
| Compound Name | 2-bromo-8-[2-(4-bromo-2-methyl-1H-inden-1-yl)propan-2-yl]-5,7-dimethyl-2,3,4,4a,5,5a,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[g]quinoline |
|---|---|
| PubChem CID | 91046352 |
| Molecular Formula | C27H37Br2N |
| Molecular Weight | 535.41 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 2-bromo-8-[2-(4-bromo-2-methyl-1H-inden-1-yl)propan-2-yl]-5,7-dimethyl-2,3,4,4a,5,5a,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[g]quinoline |
| SMILES | CC1=Cc2c(Br)cccc2C1C(C)(C)C1C(C)CC2C(C)C3CCC(Br)NC3CC21 |
| InChI | InChI=1S/C27H37Br2N/c1-14-11-19-16(3)17-9-10-24(29)30-23(17)13-21(19)26(14)27(4,5)25-15(2)12-20-18(25)7-6-8-22(20)28/h6-8,12,14,16-17,19,21,23-26,30H,9-11,13H2,1-5H3 |
| InChIKey | FSSDYSOMDMGSRG-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.41 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|