C21H20FN5O3 — CID 91046680
7-fluoro-3-(hydroxymethyl)-6-[5-methyl-4-(2-methyltetrazol-5-yl)cyclohepta-1,3,6-trien-1-yl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one (PubChem CID 91046680) has the molecular formula C21H20FN5O3 and a molecular weight of 409.42 g/mol. Its IUPAC name is 7-fluoro-3-(hydroxymethyl)-6-[5-methyl-4-(2-methyltetrazol-5-yl)cyclohepta-1,3,6-trien-1-yl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one.
| Compound Name | 7-fluoro-3-(hydroxymethyl)-6-[5-methyl-4-(2-methyltetrazol-5-yl)cyclohepta-1,3,6-trien-1-yl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one |
|---|---|
| PubChem CID | 91046680 |
| Molecular Formula | C21H20FN5O3 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 7-fluoro-3-(hydroxymethyl)-6-[5-methyl-4-(2-methyltetrazol-5-yl)cyclohepta-1,3,6-trien-1-yl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-1-one |
| SMILES | CC1C=CC(c2cc3c(cc2F)N2C(=O)OC(CO)C2C3)=CC=C1c1nnn(C)n1 |
| InChI | InChI=1S/C21H20FN5O3/c1-11-3-4-12(5-6-14(11)20-23-25-26(2)24-20)15-7-13-8-18-19(10-28)30-21(29)27(18)17(13)9-16(15)22/h3-7,9,11,18-19,28H,8,10H2,1-2H3 |
| InChIKey | LFQFRVDFOQBVNA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |