C29H54N4 — CID 91046829
8,12-diethyl-2,3,7,13,17,18-hexamethyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin (PubChem CID 91046829) has the molecular formula C29H54N4 and a molecular weight of 458.78 g/mol. Its IUPAC name is 8,12-diethyl-2,3,7,13,17,18-hexamethyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin.
| Compound Name | 8,12-diethyl-2,3,7,13,17,18-hexamethyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin |
|---|---|
| PubChem CID | 91046829 |
| Molecular Formula | C29H54N4 |
| Molecular Weight | 458.78 g/mol |
| Exact Mass | 458.43 |
| IUPAC Name | 8,12-diethyl-2,3,7,13,17,18-hexamethyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin |
| SMILES | CCC1C2CC3NC(CC4NC(C(C)C4C)C4NC(CC(N2)C1C)C(C)C4C)C(C)C3CC |
| InChI | InChI=1S/C29H54N4/c1-9-20-18(7)24-11-22-14(3)16(5)28(32-22)29-17(6)15(4)23(33-29)12-25-19(8)21(10-2)27(31-25)13-26(20)30-24/h14-33H,9-13H2,1-8H3 |
| InChIKey | IROONZCHGFVSEX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.78 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |