C22H45N — CID 91046982
3-(2,2-dimethylhexyl)-N,3,4,4,7-pentamethylnon-8-en-1-amine (PubChem CID 91046982) has the molecular formula C22H45N and a molecular weight of 323.61 g/mol. Its IUPAC name is 3-(2,2-dimethylhexyl)-N,3,4,4,7-pentamethylnon-8-en-1-amine.
| Compound Name | 3-(2,2-dimethylhexyl)-N,3,4,4,7-pentamethylnon-8-en-1-amine |
|---|---|
| PubChem CID | 91046982 |
| Molecular Formula | C22H45N |
| Molecular Weight | 323.61 g/mol |
| Exact Mass | 323.36 |
| IUPAC Name | 3-(2,2-dimethylhexyl)-N,3,4,4,7-pentamethylnon-8-en-1-amine |
| SMILES | C=CC(C)CCC(C)(C)C(C)(CCNC)CC(C)(C)CCCC |
| InChI | InChI=1S/C22H45N/c1-10-12-14-20(4,5)18-22(8,16-17-23-9)21(6,7)15-13-19(3)11-2/h11,19,23H,2,10,12-18H2,1,3-9H3 |
| InChIKey | ADWJPKHPOKBKDU-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.61 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|