About trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane
trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane (PubChem CID 91047172) has the molecular formula C15H24O3Si
and a molecular weight of 280.44 g/mol. Its IUPAC name is trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane.
Molecular Properties
| Compound Name | trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane |
| PubChem CID | 91047172 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane |
| SMILES | CO[Si](OC)(OC)C1CC23CC4C=CCC2C4C1C3 |
| InChI | InChI=1S/C15H24O3Si/c1-16-19(17-2,18-3)13-9-15-7-10-5-4-6-12(15)14(10)11(13)8-15/h4-5,10-14H,6-9H2,1-3H3 |
| InChIKey | YNYSKEAVFDBBJW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane?
The IUPAC name of trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane (CID 91047172) is trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane.
What is the SMILES notation for trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane?
The canonical SMILES for trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane is CO[Si](OC)(OC)C1CC23CC4C=CCC2C4C1C3.
What is the InChIKey of trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane?
The InChIKey is YNYSKEAVFDBBJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3Si/c1-16-19(17-2,18-3)13-9-15-7-10-5-4-6-12(15)14(10)11(13)8-15/h4-5,10-14H,6-9H2,1-3H3.
What are the key properties of trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane?
trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane has a molecular weight of 280.44 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxy(10-tetracyclo[7.2.1.01,7.03,8]dodec-4-enyl)silane is sourced from PubChem (CID 91047172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).