About 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde
6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde (PubChem CID 91047323) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde.
Molecular Properties
| Compound Name | 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde |
| PubChem CID | 91047323 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde |
| SMILES | O=CC1COCC(CC2=CC=CCC2)O1 |
| InChI | InChI=1S/C12H16O3/c13-7-12-9-14-8-11(15-12)6-10-4-2-1-3-5-10/h1-2,4,7,11-12H,3,5-6,8-9H2 |
| InChIKey | QODUKDIXKIJIBW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde?
The IUPAC name of 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde (CID 91047323) is 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde.
What is the SMILES notation for 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde?
The canonical SMILES for 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde is O=CC1COCC(CC2=CC=CCC2)O1.
What is the InChIKey of 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde?
The InChIKey is QODUKDIXKIJIBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c13-7-12-9-14-8-11(15-12)6-10-4-2-1-3-5-10/h1-2,4,7,11-12H,3,5-6,8-9H2.
What are the key properties of 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde?
6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde has a molecular weight of 208.26 g/mol, XLogP of 1.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxane-2-carbaldehyde is sourced from PubChem (CID 91047323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).