About N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine
N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine (PubChem CID 91047556) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine.
Molecular Properties
| Compound Name | N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine |
| PubChem CID | 91047556 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine |
| SMILES | CC1=C/C(=N\Cc2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C14H17NO/c1-11-8-14(9-12(2)16-11)15-10-13-6-4-3-5-7-13/h3-8,12H,9-10H2,1-2H3/b15-14+ |
| InChIKey | JMYYLMPPDLNVFF-CCEZHUSRSA-N |
| XLogP | 3.34 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine?
The IUPAC name of N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine (CID 91047556) is N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine.
What is the SMILES notation for N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine?
The canonical SMILES for N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine is CC1=C/C(=N\Cc2ccccc2)CC(C)O1.
What is the InChIKey of N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine?
The InChIKey is JMYYLMPPDLNVFF-CCEZHUSRSA-N. The full InChI is InChI=1S/C14H17NO/c1-11-8-14(9-12(2)16-11)15-10-13-6-4-3-5-7-13/h3-8,12H,9-10H2,1-2H3/b15-14+.
What are the key properties of N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine?
N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine has a molecular weight of 215.30 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,6-dimethyl-2,3-dihydropyran-4-imine is sourced from PubChem (CID 91047556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).