C11H13NO — CID 91047891
N-cyclohepta-1,3,4,6-tetraen-1-ylbutanamide (PubChem CID 91047891) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is N-cyclohepta-1,3,4,6-tetraen-1-ylbutanamide.
| Compound Name | N-cyclohepta-1,3,4,6-tetraen-1-ylbutanamide |
|---|---|
| PubChem CID | 91047891 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | N-cyclohepta-1,3,4,6-tetraen-1-ylbutanamide |
| SMILES | CCCC(=O)NC1=CC=C=CC=C1 |
| InChI | InChI=1S/C11H13NO/c1-2-7-11(13)12-10-8-5-3-4-6-9-10/h3,5-6,8-9H,2,7H2,1H3,(H,12,13) |
| InChIKey | RHQFQQARLYGSEJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |