C14H10FN2O2S- — CID 91048066
4-(6-fluoro-2-methylbenzimidazol-1-yl)benzenesulfinate (PubChem CID 91048066) has the molecular formula C14H10FN2O2S- and a molecular weight of 289.31 g/mol. Its IUPAC name is 4-(6-fluoro-2-methylbenzimidazol-1-yl)benzenesulfinate.
| Compound Name | 4-(6-fluoro-2-methylbenzimidazol-1-yl)benzenesulfinate |
|---|---|
| PubChem CID | 91048066 |
| Molecular Formula | C14H10FN2O2S- |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 4-(6-fluoro-2-methylbenzimidazol-1-yl)benzenesulfinate |
| SMILES | Cc1nc2ccc(F)cc2n1-c1ccc(S(=O)[O-])cc1 |
| InChI | InChI=1S/C14H11FN2O2S/c1-9-16-13-7-2-10(15)8-14(13)17(9)11-3-5-12(6-4-11)20(18)19/h2-8H,1H3,(H,18,19)/p-1 |
| InChIKey | WOEUZLKZNQXCQQ-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|