About 10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene
10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene (PubChem CID 91048854) has the molecular formula C18H30O
and a molecular weight of 262.44 g/mol. Its IUPAC name is 10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene.
Molecular Properties
| Compound Name | 10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene |
| PubChem CID | 91048854 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene |
| SMILES | CC(CC(C)(C)C)C1OC23C=CCCC2CCC1C3 |
| InChI | InChI=1S/C18H30O/c1-13(11-17(2,3)4)16-14-8-9-15-7-5-6-10-18(15,12-14)19-16/h6,10,13-16H,5,7-9,11-12H2,1-4H3 |
| InChIKey | QYERGVHKBHKPOL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene?
The IUPAC name of 10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene (CID 91048854) is 10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene.
What is the SMILES notation for 10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene?
The canonical SMILES for 10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene is CC(CC(C)(C)C)C1OC23C=CCCC2CCC1C3.
What is the InChIKey of 10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene?
The InChIKey is QYERGVHKBHKPOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O/c1-13(11-17(2,3)4)16-14-8-9-15-7-5-6-10-18(15,12-14)19-16/h6,10,13-16H,5,7-9,11-12H2,1-4H3.
What are the key properties of 10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene?
10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene has a molecular weight of 262.44 g/mol, XLogP of 4.96, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(4,4-dimethylpentan-2-yl)-11-oxatricyclo[7.2.1.01,6]dodec-2-ene is sourced from PubChem (CID 91048854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).