About 8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione
8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione (PubChem CID 91048871) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione.
Molecular Properties
| Compound Name | 8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione |
| PubChem CID | 91048871 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione |
| SMILES | CC1CCCC2(OC(=O)CCC2=O)O1 |
| InChI | InChI=1S/C10H14O4/c1-7-3-2-6-10(13-7)8(11)4-5-9(12)14-10/h7H,2-6H2,1H3 |
| InChIKey | ABIBGQNZHPIVGH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione?
The IUPAC name of 8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione (CID 91048871) is 8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione.
What is the SMILES notation for 8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione?
The canonical SMILES for 8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione is CC1CCCC2(OC(=O)CCC2=O)O1.
What is the InChIKey of 8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione?
The InChIKey is ABIBGQNZHPIVGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-7-3-2-6-10(13-7)8(11)4-5-9(12)14-10/h7H,2-6H2,1H3.
What are the key properties of 8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione?
8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione has a molecular weight of 198.22 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,7-dioxaspiro[5.5]undecane-2,5-dione is sourced from PubChem (CID 91048871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).