About 6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one
6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one (PubChem CID 91049511) has the molecular formula C17H21FO2
and a molecular weight of 276.35 g/mol. Its IUPAC name is 6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one.
Molecular Properties
| Compound Name | 6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one |
| PubChem CID | 91049511 |
| Molecular Formula | C17H21FO2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one |
| SMILES | CCc1cc2c(cc1F)CC1(CCC(OC)CC1)C2=O |
| InChI | InChI=1S/C17H21FO2/c1-3-11-8-14-12(9-15(11)18)10-17(16(14)19)6-4-13(20-2)5-7-17/h8-9,13H,3-7,10H2,1-2H3 |
| InChIKey | MPQICHUJBYFZCU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
The IUPAC name of 6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one (CID 91049511) is 6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one.
What is the SMILES notation for 6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
The canonical SMILES for 6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one is CCc1cc2c(cc1F)CC1(CCC(OC)CC1)C2=O.
What is the InChIKey of 6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
The InChIKey is MPQICHUJBYFZCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21FO2/c1-3-11-8-14-12(9-15(11)18)10-17(16(14)19)6-4-13(20-2)5-7-17/h8-9,13H,3-7,10H2,1-2H3.
What are the key properties of 6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one has a molecular weight of 276.35 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-5-fluoro-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-one is sourced from PubChem (CID 91049511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).