C31H40F4N2O9 — CID 91049740
[(2R,3R,4S,5R)-3,4-diacetyloxy-2-methoxy-8-methyl-1-oxo-1-[[(3S)-2-oxo-1-[(2,3,5,6-tetrafluorophenyl)methyl]azepan-3-yl]amino]dec-6-en-5-yl] acetate (PubChem CID 91049740) has the molecular formula C31H40F4N2O9 and a molecular weight of 660.66 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4-diacetyloxy-2-methoxy-8-methyl-1-oxo-1-[[(3S)-2-oxo-1-[(2,3,5,6-tetrafluorophenyl)methyl]azepan-3-yl]amino]dec-6-en-5-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-2-methoxy-8-methyl-1-oxo-1-[[(3S)-2-oxo-1-[(2,3,5,6-tetrafluorophenyl)methyl]azepan-3-yl]amino]dec-6-en-5-yl] acetate |
|---|---|
| PubChem CID | 91049740 |
| Molecular Formula | C31H40F4N2O9 |
| Molecular Weight | 660.66 g/mol |
| Exact Mass | 660.27 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-2-methoxy-8-methyl-1-oxo-1-[[(3S)-2-oxo-1-[(2,3,5,6-tetrafluorophenyl)methyl]azepan-3-yl]amino]dec-6-en-5-yl] acetate |
| SMILES | CCC(C)C=C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC)C(=O)N[C@H]1CCCCN(Cc2c(F)c(F)cc(F)c2F)C1=O |
| InChI | InChI=1S/C31H40F4N2O9/c1-7-16(2)11-12-24(44-17(3)38)27(45-18(4)39)28(46-19(5)40)29(43-6)30(41)36-23-10-8-9-13-37(31(23)42)15-20-25(34)21(32)14-22(33)26(20)35/h11-12,14,16,23-24,27-29H,7-10,13,15H2,1-6H3,(H,36,41)/t16?,23-,24+,27-,28+,29+/m0/s1 |
| InChIKey | QZFMUUIPTWSLFP-CYZAPZEHSA-N |
| XLogP | 3.65 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|