C16H32O4Si — CID 91050413
(2R,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid (PubChem CID 91050413) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid.
| Compound Name | (2R,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid |
|---|---|
| PubChem CID | 91050413 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (2R,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethyloct-6-enoic acid |
| SMILES | CC=C[C@@H](O)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C16H32O4Si/c1-9-10-13(17)11(2)14(12(3)15(18)19)20-21(7,8)16(4,5)6/h9-14,17H,1-8H3,(H,18,19)/t11-,12+,13+,14-/m0/s1 |
| InChIKey | YIIYIVJUXVDQCE-DGAVXFQQSA-N |
| XLogP | 3.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|