About 5-fluoro-2-methylidenehexa-3,5-dienoyl chloride
5-fluoro-2-methylidenehexa-3,5-dienoyl chloride (PubChem CID 91050419) has the molecular formula C7H6ClFO
and a molecular weight of 160.57 g/mol. Its IUPAC name is 5-fluoro-2-methylidenehexa-3,5-dienoyl chloride.
Molecular Properties
| Compound Name | 5-fluoro-2-methylidenehexa-3,5-dienoyl chloride |
| PubChem CID | 91050419 |
| Molecular Formula | C7H6ClFO |
| Molecular Weight | 160.57 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 5-fluoro-2-methylidenehexa-3,5-dienoyl chloride |
| SMILES | C=C(F)C=CC(=C)C(=O)Cl |
| InChI | InChI=1S/C7H6ClFO/c1-5(7(8)10)3-4-6(2)9/h3-4H,1-2H2 |
| InChIKey | LFEWPACPJGSNKZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-methylidenehexa-3,5-dienoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methylidenehexa-3,5-dienoyl chloride?
The IUPAC name of 5-fluoro-2-methylidenehexa-3,5-dienoyl chloride (CID 91050419) is 5-fluoro-2-methylidenehexa-3,5-dienoyl chloride.
What is the SMILES notation for 5-fluoro-2-methylidenehexa-3,5-dienoyl chloride?
The canonical SMILES for 5-fluoro-2-methylidenehexa-3,5-dienoyl chloride is C=C(F)C=CC(=C)C(=O)Cl.
What is the InChIKey of 5-fluoro-2-methylidenehexa-3,5-dienoyl chloride?
The InChIKey is LFEWPACPJGSNKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClFO/c1-5(7(8)10)3-4-6(2)9/h3-4H,1-2H2.
What are the key properties of 5-fluoro-2-methylidenehexa-3,5-dienoyl chloride?
5-fluoro-2-methylidenehexa-3,5-dienoyl chloride has a molecular weight of 160.57 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methylidenehexa-3,5-dienoyl chloride is sourced from PubChem (CID 91050419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).