About N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine
N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine (PubChem CID 91050499) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine.
Molecular Properties
| Compound Name | N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine |
| PubChem CID | 91050499 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine |
| SMILES | C/N=C/C1=C(C)CNC1 |
| InChI | InChI=1S/C7H12N2/c1-6-3-9-5-7(6)4-8-2/h4,9H,3,5H2,1-2H3/b8-4+ |
| InChIKey | ZEXRFEMBBIUTGN-XBXARRHUSA-N |
| XLogP | 0.61 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine?
The IUPAC name of N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine (CID 91050499) is N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine.
What is the SMILES notation for N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine?
The canonical SMILES for N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine is C/N=C/C1=C(C)CNC1.
What is the InChIKey of N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine?
The InChIKey is ZEXRFEMBBIUTGN-XBXARRHUSA-N. The full InChI is InChI=1S/C7H12N2/c1-6-3-9-5-7(6)4-8-2/h4,9H,3,5H2,1-2H3/b8-4+.
What are the key properties of N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine?
N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine has a molecular weight of 124.19 g/mol, XLogP of 0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)methanimine is sourced from PubChem (CID 91050499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).