C24H18F3N3O3 — CID 91050731
N-hydroxy-3-[3-[1-[[3-(trifluoromethoxy)phenyl]methyl]benzimidazol-2-yl]phenyl]prop-2-enamide (PubChem CID 91050731) has the molecular formula C24H18F3N3O3 and a molecular weight of 453.42 g/mol. Its IUPAC name is N-hydroxy-3-[3-[1-[[3-(trifluoromethoxy)phenyl]methyl]benzimidazol-2-yl]phenyl]prop-2-enamide.
| Compound Name | N-hydroxy-3-[3-[1-[[3-(trifluoromethoxy)phenyl]methyl]benzimidazol-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91050731 |
| Molecular Formula | C24H18F3N3O3 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | N-hydroxy-3-[3-[1-[[3-(trifluoromethoxy)phenyl]methyl]benzimidazol-2-yl]phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(-c2nc3ccccc3n2Cc2cccc(OC(F)(F)F)c2)c1)NO |
| InChI | InChI=1S/C24H18F3N3O3/c25-24(26,27)33-19-8-4-6-17(14-19)15-30-21-10-2-1-9-20(21)28-23(30)18-7-3-5-16(13-18)11-12-22(31)29-32/h1-14,32H,15H2,(H,29,31) |
| InChIKey | XGZZOQKYBSCXOK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|