About [2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate
[2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate (PubChem CID 91050842) has the molecular formula C12H10ClNO4S
and a molecular weight of 299.74 g/mol. Its IUPAC name is [2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate |
| PubChem CID | 91050842 |
| Molecular Formula | C12H10ClNO4S |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | [2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1cnc(Oc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C12H10ClNO4S/c1-2-16-12(15)18-10-7-14-11(19-10)17-9-5-3-4-8(13)6-9/h3-7H,2H2,1H3 |
| InChIKey | BPTMCPGGVHMBHC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate?
The IUPAC name of [2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate (CID 91050842) is [2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate.
What is the SMILES notation for [2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate?
The canonical SMILES for [2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate is CCOC(=O)Oc1cnc(Oc2cccc(Cl)c2)s1.
What is the InChIKey of [2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate?
The InChIKey is BPTMCPGGVHMBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO4S/c1-2-16-12(15)18-10-7-14-11(19-10)17-9-5-3-4-8(13)6-9/h3-7H,2H2,1H3.
What are the key properties of [2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate?
[2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate has a molecular weight of 299.74 g/mol, XLogP of 4.12, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-chlorophenoxy)-1,3-thiazol-5-yl] ethyl carbonate is sourced from PubChem (CID 91050842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).