About 4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine
4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine (PubChem CID 91051236) has the molecular formula C17H14N4O
and a molecular weight of 290.33 g/mol. Its IUPAC name is 4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine.
Molecular Properties
| Compound Name | 4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine |
| PubChem CID | 91051236 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine |
| SMILES | O=NC1CCc2cc(-c3cn[nH]c3-c3ccncc3)ccc21 |
| InChI | InChI=1S/C17H14N4O/c22-21-16-4-2-12-9-13(1-3-14(12)16)15-10-19-20-17(15)11-5-7-18-8-6-11/h1,3,5-10,16H,2,4H2,(H,19,20) |
| InChIKey | QXXGBIGYGBFXEV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine?
The IUPAC name of 4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine (CID 91051236) is 4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine.
What is the SMILES notation for 4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine?
The canonical SMILES for 4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine is O=NC1CCc2cc(-c3cn[nH]c3-c3ccncc3)ccc21.
What is the InChIKey of 4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine?
The InChIKey is QXXGBIGYGBFXEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4O/c22-21-16-4-2-12-9-13(1-3-14(12)16)15-10-19-20-17(15)11-5-7-18-8-6-11/h1,3,5-10,16H,2,4H2,(H,19,20).
What are the key properties of 4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine?
4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine has a molecular weight of 290.33 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1-nitroso-2,3-dihydro-1H-inden-5-yl)-1H-pyrazol-5-yl]pyridine is sourced from PubChem (CID 91051236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).