C14H18F4O — CID 91051466
2-(1,1-difluoro-3-methylhexa-1,5-dien-2-yl)oxy-1,1-difluoro-3-methylhexa-1,5-diene (PubChem CID 91051466) has the molecular formula C14H18F4O and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-(1,1-difluoro-3-methylhexa-1,5-dien-2-yl)oxy-1,1-difluoro-3-methylhexa-1,5-diene.
| Compound Name | 2-(1,1-difluoro-3-methylhexa-1,5-dien-2-yl)oxy-1,1-difluoro-3-methylhexa-1,5-diene |
|---|---|
| PubChem CID | 91051466 |
| Molecular Formula | C14H18F4O |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-(1,1-difluoro-3-methylhexa-1,5-dien-2-yl)oxy-1,1-difluoro-3-methylhexa-1,5-diene |
| SMILES | C=CCC(C)C(OC(=C(F)F)C(C)CC=C)=C(F)F |
| InChI | InChI=1S/C14H18F4O/c1-5-7-9(3)11(13(15)16)19-12(14(17)18)10(4)8-6-2/h5-6,9-10H,1-2,7-8H2,3-4H3 |
| InChIKey | SQJUPMWRSOEBOL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|