C4Cl3F3O2 — CID 91051920
1,1,1-trichloro-4,4,4-trifluorobutane-2,3-dione (PubChem CID 91051920) has the molecular formula C4Cl3F3O2 and a molecular weight of 243.39 g/mol. Its IUPAC name is 1,1,1-trichloro-4,4,4-trifluorobutane-2,3-dione.
| Compound Name | 1,1,1-trichloro-4,4,4-trifluorobutane-2,3-dione |
|---|---|
| PubChem CID | 91051920 |
| Molecular Formula | C4Cl3F3O2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 241.89 |
| IUPAC Name | 1,1,1-trichloro-4,4,4-trifluorobutane-2,3-dione |
| SMILES | O=C(C(=O)C(Cl)(Cl)Cl)C(F)(F)F |
| InChI | InChI=1S/C4Cl3F3O2/c5-3(6,7)1(11)2(12)4(8,9)10 |
| InChIKey | BUPCQQVNWAGPKW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|