C13H20O4 — CID 91051973
5-[2-(methoxymethoxy)ethyl]-4,5-dimethyl-2-oxocyclohex-3-ene-1-carbaldehyde (PubChem CID 91051973) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 5-[2-(methoxymethoxy)ethyl]-4,5-dimethyl-2-oxocyclohex-3-ene-1-carbaldehyde.
| Compound Name | 5-[2-(methoxymethoxy)ethyl]-4,5-dimethyl-2-oxocyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 91051973 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-[2-(methoxymethoxy)ethyl]-4,5-dimethyl-2-oxocyclohex-3-ene-1-carbaldehyde |
| SMILES | COCOCCC1(C)CC(C=O)C(=O)C=C1C |
| InChI | InChI=1S/C13H20O4/c1-10-6-12(15)11(8-14)7-13(10,2)4-5-17-9-16-3/h6,8,11H,4-5,7,9H2,1-3H3 |
| InChIKey | UWEADUMSOODROP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|