About N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine
N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine (PubChem CID 91052031) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine.
Molecular Properties
| Compound Name | N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine |
| PubChem CID | 91052031 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine |
| SMILES | C=C/C=C/C(=C)/N=C/C |
| InChI | InChI=1S/C8H11N/c1-4-6-7-8(3)9-5-2/h4-7H,1,3H2,2H3/b7-6+,9-5+ |
| InChIKey | UBGGXXNDMGMFPH-CQCRHSALSA-N |
| XLogP | 2.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine?
The IUPAC name of N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine (CID 91052031) is N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine.
What is the SMILES notation for N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine?
The canonical SMILES for N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine is C=C/C=C/C(=C)/N=C/C.
What is the InChIKey of N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine?
The InChIKey is UBGGXXNDMGMFPH-CQCRHSALSA-N. The full InChI is InChI=1S/C8H11N/c1-4-6-7-8(3)9-5-2/h4-7H,1,3H2,2H3/b7-6+,9-5+.
What are the key properties of N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine?
N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine has a molecular weight of 121.18 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-hexa-1,3,5-trien-2-yl]ethanimine is sourced from PubChem (CID 91052031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).