C20H26F6O — CID 91052120
2-(1,2-ditert-butyl-2,3-dihydro-1H-inden-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 91052120) has the molecular formula C20H26F6O and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-(1,2-ditert-butyl-2,3-dihydro-1H-inden-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(1,2-ditert-butyl-2,3-dihydro-1H-inden-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 91052120 |
| Molecular Formula | C20H26F6O |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2-(1,2-ditert-butyl-2,3-dihydro-1H-inden-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC(C)(C)C1Cc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2C1C(C)(C)C |
| InChI | InChI=1S/C20H26F6O/c1-16(2,3)14-10-11-9-12(7-8-13(11)15(14)17(4,5)6)18(27,19(21,22)23)20(24,25)26/h7-9,14-15,27H,10H2,1-6H3 |
| InChIKey | SXKOEBGWAXPSIC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |