C22H37NO2 — CID 91052137
3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,5,6-tetramethylpyridin-2-one;ethane (PubChem CID 91052137) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,5,6-tetramethylpyridin-2-one;ethane.
| Compound Name | 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,5,6-tetramethylpyridin-2-one;ethane |
|---|---|
| PubChem CID | 91052137 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,5,6-tetramethylpyridin-2-one;ethane |
| SMILES | CC.CC.Cc1c(C)c(C)n(C)c(=O)c1C(=O)/C=C/C1CCCCC1 |
| InChI | InChI=1S/C18H25NO2.2C2H6/c1-12-13(2)17(18(21)19(4)14(12)3)16(20)11-10-15-8-6-5-7-9-15;2*1-2/h10-11,15H,5-9H2,1-4H3;2*1-2H3/b11-10+;; |
| InChIKey | YKHRMEYFRCIYID-BGNBUWATSA-N |
| XLogP | 5.68 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|