C26H29N3O9 — CID 91052341
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxycarbonylamino]hexyl carbonate (PubChem CID 91052341) has the molecular formula C26H29N3O9 and a molecular weight of 527.53 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxycarbonylamino]hexyl carbonate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxycarbonylamino]hexyl carbonate |
|---|---|
| PubChem CID | 91052341 |
| Molecular Formula | C26H29N3O9 |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxycarbonylamino]hexyl carbonate |
| SMILES | O=C(NCCCCCCOC(=O)On1c(O)c2c(c1O)C1C=CC2C1)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C26H29N3O9/c30-21-17-13-5-6-14(11-13)18(17)22(31)28(21)37-25(34)27-9-3-1-2-4-10-36-26(35)38-29-23(32)19-15-7-8-16(12-15)20(19)24(29)33/h5-8,13-16,30-33H,1-4,9-12H2,(H,27,34) |
| InChIKey | BGCUOKMRJBBKHR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 164.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|