About 6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole
6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole (PubChem CID 91052701) has the molecular formula C18H19N3O5
and a molecular weight of 357.37 g/mol. Its IUPAC name is 6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole.
Molecular Properties
| Compound Name | 6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole |
| PubChem CID | 91052701 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole |
| SMILES | COc1ccc2c(C(N=O)c3cc(OC)c(OC)c(OC)c3)[nH]nc2c1 |
| InChI | InChI=1S/C18H19N3O5/c1-23-11-5-6-12-13(9-11)19-20-17(12)16(21-22)10-7-14(24-2)18(26-4)15(8-10)25-3/h5-9,16H,1-4H3,(H,19,20) |
| InChIKey | KASPIGWUGYOZHJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 95.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole?
The IUPAC name of 6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole (CID 91052701) is 6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole.
What is the SMILES notation for 6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole?
The canonical SMILES for 6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole is COc1ccc2c(C(N=O)c3cc(OC)c(OC)c(OC)c3)[nH]nc2c1.
What is the InChIKey of 6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole?
The InChIKey is KASPIGWUGYOZHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O5/c1-23-11-5-6-12-13(9-11)19-20-17(12)16(21-22)10-7-14(24-2)18(26-4)15(8-10)25-3/h5-9,16H,1-4H3,(H,19,20).
What are the key properties of 6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole?
6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole has a molecular weight of 357.37 g/mol, XLogP of 3.45, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3-[nitroso-(3,4,5-trimethoxyphenyl)methyl]-2H-indazole is sourced from PubChem (CID 91052701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).