C17H20F13NO — CID 91052840
N-butyl-N-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecan-4-yl)prop-2-enamide (PubChem CID 91052840) has the molecular formula C17H20F13NO and a molecular weight of 501.33 g/mol. Its IUPAC name is N-butyl-N-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecan-4-yl)prop-2-enamide.
| Compound Name | N-butyl-N-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecan-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 91052840 |
| Molecular Formula | C17H20F13NO |
| Molecular Weight | 501.33 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | N-butyl-N-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecan-4-yl)prop-2-enamide |
| SMILES | C=CC(=O)N(CCCC)C(CCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H20F13NO/c1-4-7-9-31(11(32)6-3)10(8-5-2)12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h6,10H,3-5,7-9H2,1-2H3 |
| InChIKey | LDXAJVQKAKQGRH-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.33 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|