About thieno[2,3-d]pyrimidin-2-ylhydrazine
thieno[2,3-d]pyrimidin-2-ylhydrazine (PubChem CID 91053414) has the molecular formula C6H6N4S
and a molecular weight of 166.21 g/mol. Its IUPAC name is thieno[2,3-d]pyrimidin-2-ylhydrazine.
Molecular Properties
| Compound Name | thieno[2,3-d]pyrimidin-2-ylhydrazine |
| PubChem CID | 91053414 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | thieno[2,3-d]pyrimidin-2-ylhydrazine |
| SMILES | NNc1ncc2ccsc2n1 |
| InChI | InChI=1S/C6H6N4S/c7-10-6-8-3-4-1-2-11-5(4)9-6/h1-3H,7H2,(H,8,9,10) |
| InChIKey | GQEDPIMHHWXXBI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze thieno[2,3-d]pyrimidin-2-ylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-d]pyrimidin-2-ylhydrazine?
The IUPAC name of thieno[2,3-d]pyrimidin-2-ylhydrazine (CID 91053414) is thieno[2,3-d]pyrimidin-2-ylhydrazine.
What is the SMILES notation for thieno[2,3-d]pyrimidin-2-ylhydrazine?
The canonical SMILES for thieno[2,3-d]pyrimidin-2-ylhydrazine is NNc1ncc2ccsc2n1.
What is the InChIKey of thieno[2,3-d]pyrimidin-2-ylhydrazine?
The InChIKey is GQEDPIMHHWXXBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S/c7-10-6-8-3-4-1-2-11-5(4)9-6/h1-3H,7H2,(H,8,9,10).
What are the key properties of thieno[2,3-d]pyrimidin-2-ylhydrazine?
thieno[2,3-d]pyrimidin-2-ylhydrazine has a molecular weight of 166.21 g/mol, XLogP of 0.98, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-d]pyrimidin-2-ylhydrazine is sourced from PubChem (CID 91053414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).