C8H11N — CID 91053481
(E)-N,4-dimethylhex-3-en-5-yn-2-imine (PubChem CID 91053481) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is (E)-N,4-dimethylhex-3-en-5-yn-2-imine.
| Compound Name | (E)-N,4-dimethylhex-3-en-5-yn-2-imine |
|---|---|
| PubChem CID | 91053481 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | (E)-N,4-dimethylhex-3-en-5-yn-2-imine |
| SMILES | C#C/C(C)=C/C(C)=N/C |
| InChI | InChI=1S/C8H11N/c1-5-7(2)6-8(3)9-4/h1,6H,2-4H3/b7-6+,9-8+ |
| InChIKey | GNXJARVLRVUQFE-BLHCBFLLSA-N |
| XLogP | 1.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|