C13H18ClN — CID 91053808
3-chloro-N-(cyclopropylmethyl)-N-propylaniline (PubChem CID 91053808) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is 3-chloro-N-(cyclopropylmethyl)-N-propylaniline.
| Compound Name | 3-chloro-N-(cyclopropylmethyl)-N-propylaniline |
|---|---|
| PubChem CID | 91053808 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-chloro-N-(cyclopropylmethyl)-N-propylaniline |
| SMILES | CCCN(CC1CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClN/c1-2-8-15(10-11-6-7-11)13-5-3-4-12(14)9-13/h3-5,9,11H,2,6-8,10H2,1H3 |
| InChIKey | ONAKTQFMCGZIDN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |