About 5-hexan-3-yl-1H-1,2,4-triazole
5-hexan-3-yl-1H-1,2,4-triazole (PubChem CID 91053928) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 5-hexan-3-yl-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-hexan-3-yl-1H-1,2,4-triazole |
| PubChem CID | 91053928 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 5-hexan-3-yl-1H-1,2,4-triazole |
| SMILES | CCCC(CC)c1ncn[nH]1 |
| InChI | InChI=1S/C8H15N3/c1-3-5-7(4-2)8-9-6-10-11-8/h6-7H,3-5H2,1-2H3,(H,9,10,11) |
| InChIKey | IAWCUFOMVWOVBT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hexan-3-yl-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexan-3-yl-1H-1,2,4-triazole?
The IUPAC name of 5-hexan-3-yl-1H-1,2,4-triazole (CID 91053928) is 5-hexan-3-yl-1H-1,2,4-triazole.
What is the SMILES notation for 5-hexan-3-yl-1H-1,2,4-triazole?
The canonical SMILES for 5-hexan-3-yl-1H-1,2,4-triazole is CCCC(CC)c1ncn[nH]1.
What is the InChIKey of 5-hexan-3-yl-1H-1,2,4-triazole?
The InChIKey is IAWCUFOMVWOVBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-3-5-7(4-2)8-9-6-10-11-8/h6-7H,3-5H2,1-2H3,(H,9,10,11).
What are the key properties of 5-hexan-3-yl-1H-1,2,4-triazole?
5-hexan-3-yl-1H-1,2,4-triazole has a molecular weight of 153.23 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexan-3-yl-1H-1,2,4-triazole is sourced from PubChem (CID 91053928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).