C27H40O4 — CID 91053996
(2S,3S)-2-[(5R,11R,13S,14R)-3-ethyl-14-hydroxy-5,9,11,13-tetramethyl-12-oxopentadeca-1,3,7,9-tetraenyl]-3-methyl-2,3-dihydropyran-6-one (PubChem CID 91053996) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is (2S,3S)-2-[(5R,11R,13S,14R)-3-ethyl-14-hydroxy-5,9,11,13-tetramethyl-12-oxopentadeca-1,3,7,9-tetraenyl]-3-methyl-2,3-dihydropyran-6-one.
| Compound Name | (2S,3S)-2-[(5R,11R,13S,14R)-3-ethyl-14-hydroxy-5,9,11,13-tetramethyl-12-oxopentadeca-1,3,7,9-tetraenyl]-3-methyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 91053996 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | (2S,3S)-2-[(5R,11R,13S,14R)-3-ethyl-14-hydroxy-5,9,11,13-tetramethyl-12-oxopentadeca-1,3,7,9-tetraenyl]-3-methyl-2,3-dihydropyran-6-one |
| SMILES | CCC(C=C[C@@H]1OC(=O)C=C[C@@H]1C)=C[C@H](C)CC=CC(C)=C[C@@H](C)C(=O)[C@@H](C)[C@@H](C)O |
| InChI | InChI=1S/C27H40O4/c1-8-24(13-14-25-20(4)12-15-26(29)31-25)17-19(3)11-9-10-18(2)16-21(5)27(30)22(6)23(7)28/h9-10,12-17,19-23,25,28H,8,11H2,1-7H3/t19-,20+,21-,22+,23-,25+/m1/s1 |
| InChIKey | USVUBIMZLMCPQO-CFMRDJJBSA-N |
| XLogP | 5.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|