C33H41ClN2O6 — CID 91054788
(8S)-N-[(2S)-1-[[(4R)-7-chloro-4-hydroxyocta-1,6-dienyl]amino]-1-oxo-3-phenylpropan-2-yl]-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienamide (PubChem CID 91054788) has the molecular formula C33H41ClN2O6 and a molecular weight of 597.15 g/mol. Its IUPAC name is (8S)-N-[(2S)-1-[[(4R)-7-chloro-4-hydroxyocta-1,6-dienyl]amino]-1-oxo-3-phenylpropan-2-yl]-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienamide.
| Compound Name | (8S)-N-[(2S)-1-[[(4R)-7-chloro-4-hydroxyocta-1,6-dienyl]amino]-1-oxo-3-phenylpropan-2-yl]-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienamide |
|---|---|
| PubChem CID | 91054788 |
| Molecular Formula | C33H41ClN2O6 |
| Molecular Weight | 597.15 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | (8S)-N-[(2S)-1-[[(4R)-7-chloro-4-hydroxyocta-1,6-dienyl]amino]-1-oxo-3-phenylpropan-2-yl]-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienamide |
| SMILES | COC1=CC[C@@H]([C@@H](C)C=C(C)C=CC=CC(=O)N[C@@H](Cc2ccccc2)C(=O)NC=CC[C@@H](O)CC=C(C)Cl)OC1=O |
| InChI | InChI=1S/C33H41ClN2O6/c1-23(21-24(2)29-18-19-30(41-4)33(40)42-29)11-8-9-15-31(38)36-28(22-26-12-6-5-7-13-26)32(39)35-20-10-14-27(37)17-16-25(3)34/h5-13,15-16,19-21,24,27-29,37H,14,17-18,22H2,1-4H3,(H,35,39)(H,36,38)/t24-,27+,28-,29-/m0/s1 |
| InChIKey | RPBBYFAOYMNMNN-LQBCTSRJSA-N |
| XLogP | 5.17 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.15 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|