About [5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol
[5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol (PubChem CID 91054862) has the molecular formula C12H14FN3O2S
and a molecular weight of 283.33 g/mol. Its IUPAC name is [5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol |
| PubChem CID | 91054862 |
| Molecular Formula | C12H14FN3O2S |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | [5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol |
| SMILES | CC1(F)CC(CO)OC1c1scc2c(N)ncnc12 |
| InChI | InChI=1S/C12H14FN3O2S/c1-12(13)2-6(3-17)18-10(12)9-8-7(4-19-9)11(14)16-5-15-8/h4-6,10,17H,2-3H2,1H3,(H2,14,15,16) |
| InChIKey | OPKFZCBILLNAIH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol?
The IUPAC name of [5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol (CID 91054862) is [5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol.
What is the SMILES notation for [5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol?
The canonical SMILES for [5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol is CC1(F)CC(CO)OC1c1scc2c(N)ncnc12.
What is the InChIKey of [5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol?
The InChIKey is OPKFZCBILLNAIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FN3O2S/c1-12(13)2-6(3-17)18-10(12)9-8-7(4-19-9)11(14)16-5-15-8/h4-6,10,17H,2-3H2,1H3,(H2,14,15,16).
What are the key properties of [5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol?
[5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol has a molecular weight of 283.33 g/mol, XLogP of 1.82, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-4-methyloxolan-2-yl]methanol is sourced from PubChem (CID 91054862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).