About (1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate
(1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate (PubChem CID 91055597) has the molecular formula C11H18N4O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is (1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate.
Molecular Properties
| Compound Name | (1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate |
| PubChem CID | 91055597 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate |
| SMILES | NC(=O)N1CCCN=C1OC(=O)C1CCNCC1 |
| InChI | InChI=1S/C11H18N4O3/c12-10(17)15-7-1-4-14-11(15)18-9(16)8-2-5-13-6-3-8/h8,13H,1-7H2,(H2,12,17) |
| InChIKey | CDTRVXFWJRSHLE-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate?
The IUPAC name of (1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate (CID 91055597) is (1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate.
What is the SMILES notation for (1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate?
The canonical SMILES for (1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate is NC(=O)N1CCCN=C1OC(=O)C1CCNCC1.
What is the InChIKey of (1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate?
The InChIKey is CDTRVXFWJRSHLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O3/c12-10(17)15-7-1-4-14-11(15)18-9(16)8-2-5-13-6-3-8/h8,13H,1-7H2,(H2,12,17).
What are the key properties of (1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate?
(1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate has a molecular weight of 254.29 g/mol, XLogP of -0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carbamoyl-5,6-dihydro-4H-pyrimidin-2-yl) piperidine-4-carboxylate is sourced from PubChem (CID 91055597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).