C9H11NO10 — CID 91055625
2-amino-2,3,3-trihydroxy-3-(2,3,4,5,6-pentahydroxyphenyl)propanoic acid (PubChem CID 91055625) has the molecular formula C9H11NO10 and a molecular weight of 293.18 g/mol. Its IUPAC name is 2-amino-2,3,3-trihydroxy-3-(2,3,4,5,6-pentahydroxyphenyl)propanoic acid.
| Compound Name | 2-amino-2,3,3-trihydroxy-3-(2,3,4,5,6-pentahydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 91055625 |
| Molecular Formula | C9H11NO10 |
| Molecular Weight | 293.18 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-amino-2,3,3-trihydroxy-3-(2,3,4,5,6-pentahydroxyphenyl)propanoic acid |
| SMILES | NC(O)(C(=O)O)C(O)(O)c1c(O)c(O)c(O)c(O)c1O |
| InChI | InChI=1S/C9H11NO10/c10-8(18,7(16)17)9(19,20)1-2(11)4(13)6(15)5(14)3(1)12/h11-15,18-20H,10H2,(H,16,17) |
| InChIKey | JVEDOXLDIODJLQ-UHFFFAOYSA-N |
| XLogP | -2.92 |
| TPSA | 225.16 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.18 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|