About 2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane
2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane (PubChem CID 91055854) has the molecular formula C9H11F3O
and a molecular weight of 192.18 g/mol. Its IUPAC name is 2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane.
Molecular Properties
| Compound Name | 2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane |
| PubChem CID | 91055854 |
| Molecular Formula | C9H11F3O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane |
| SMILES | CF.Cc1ccc(OCF)cc1F |
| InChI | InChI=1S/C8H8F2O.CH3F/c1-6-2-3-7(11-5-9)4-8(6)10;1-2/h2-4H,5H2,1H3;1H3 |
| InChIKey | CJAGYGVBKJTJRE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane?
The IUPAC name of 2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane (CID 91055854) is 2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane.
What is the SMILES notation for 2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane?
The canonical SMILES for 2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane is CF.Cc1ccc(OCF)cc1F.
What is the InChIKey of 2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane?
The InChIKey is CJAGYGVBKJTJRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2O.CH3F/c1-6-2-3-7(11-5-9)4-8(6)10;1-2/h2-4H,5H2,1H3;1H3.
What are the key properties of 2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane?
2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane has a molecular weight of 192.18 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-(fluoromethoxy)-1-methylbenzene;fluoromethane is sourced from PubChem (CID 91055854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).