C17H34FN — CID 91055953
N-butan-2-yl-4-fluoro-N,2,4,5,6-pentamethyl-3-methylideneheptan-1-amine (PubChem CID 91055953) has the molecular formula C17H34FN and a molecular weight of 271.46 g/mol. Its IUPAC name is N-butan-2-yl-4-fluoro-N,2,4,5,6-pentamethyl-3-methylideneheptan-1-amine.
| Compound Name | N-butan-2-yl-4-fluoro-N,2,4,5,6-pentamethyl-3-methylideneheptan-1-amine |
|---|---|
| PubChem CID | 91055953 |
| Molecular Formula | C17H34FN |
| Molecular Weight | 271.46 g/mol |
| Exact Mass | 271.27 |
| IUPAC Name | N-butan-2-yl-4-fluoro-N,2,4,5,6-pentamethyl-3-methylideneheptan-1-amine |
| SMILES | C=C(C(C)CN(C)C(C)CC)C(C)(F)C(C)C(C)C |
| InChI | InChI=1S/C17H34FN/c1-10-14(5)19(9)11-13(4)16(7)17(8,18)15(6)12(2)3/h12-15H,7,10-11H2,1-6,8-9H3 |
| InChIKey | YEDVYWYKUIBULR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|