About 1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine
1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine (PubChem CID 91056081) has the molecular formula C7H11ClN2
and a molecular weight of 158.63 g/mol. Its IUPAC name is 1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine |
| PubChem CID | 91056081 |
| Molecular Formula | C7H11ClN2 |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine |
| SMILES | CNCC1=NCC(Cl)C=C1 |
| InChI | InChI=1S/C7H11ClN2/c1-9-5-7-3-2-6(8)4-10-7/h2-3,6,9H,4-5H2,1H3 |
| InChIKey | HEASIEPBZSBPPF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine?
The IUPAC name of 1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine (CID 91056081) is 1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine.
What is the SMILES notation for 1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine?
The canonical SMILES for 1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine is CNCC1=NCC(Cl)C=C1.
What is the InChIKey of 1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine?
The InChIKey is HEASIEPBZSBPPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN2/c1-9-5-7-3-2-6(8)4-10-7/h2-3,6,9H,4-5H2,1H3.
What are the key properties of 1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine?
1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine has a molecular weight of 158.63 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-2,3-dihydropyridin-6-yl)-N-methylmethanamine is sourced from PubChem (CID 91056081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).