About N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine
N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine (PubChem CID 91056225) has the molecular formula C13H31N3
and a molecular weight of 229.41 g/mol. Its IUPAC name is N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine |
| PubChem CID | 91056225 |
| Molecular Formula | C13H31N3 |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.25 |
| IUPAC Name | N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)N(C)CCN(C)CCN(C)C(C)C |
| InChI | InChI=1S/C13H31N3/c1-12(2)15(6)10-8-14(5)9-11-16(7)13(3)4/h12-13H,8-11H2,1-7H3 |
| InChIKey | HOXYZHCBGBQOJY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine?
The IUPAC name of N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine (CID 91056225) is N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine.
What is the SMILES notation for N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine?
The canonical SMILES for N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine is CC(C)N(C)CCN(C)CCN(C)C(C)C.
What is the InChIKey of N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine?
The InChIKey is HOXYZHCBGBQOJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H31N3/c1-12(2)15(6)10-8-14(5)9-11-16(7)13(3)4/h12-13H,8-11H2,1-7H3.
What are the key properties of N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine?
N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine has a molecular weight of 229.41 g/mol, XLogP of 1.60, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]-N'-propan-2-ylethane-1,2-diamine is sourced from PubChem (CID 91056225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).