About dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane
dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane (PubChem CID 91056359) has the molecular formula C17H23NO5
and a molecular weight of 321.37 g/mol. Its IUPAC name is dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane.
Molecular Properties
| Compound Name | dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane |
| PubChem CID | 91056359 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane |
| SMILES | CC.COC(=O)C1(C(=O)OC)Cc2ccccc2CN1C(C)=O |
| InChI | InChI=1S/C15H17NO5.C2H6/c1-10(17)16-9-12-7-5-4-6-11(12)8-15(16,13(18)20-2)14(19)21-3;1-2/h4-7H,8-9H2,1-3H3;1-2H3 |
| InChIKey | FNDVJJUXUQXVOH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane?
The IUPAC name of dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane (CID 91056359) is dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane.
What is the SMILES notation for dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane?
The canonical SMILES for dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane is CC.COC(=O)C1(C(=O)OC)Cc2ccccc2CN1C(C)=O.
What is the InChIKey of dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane?
The InChIKey is FNDVJJUXUQXVOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO5.C2H6/c1-10(17)16-9-12-7-5-4-6-11(12)8-15(16,13(18)20-2)14(19)21-3;1-2/h4-7H,8-9H2,1-3H3;1-2H3.
What are the key properties of dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane?
dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane has a molecular weight of 321.37 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-acetyl-1,4-dihydroisoquinoline-3,3-dicarboxylate;ethane is sourced from PubChem (CID 91056359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).