About 3-benzyl-1H-imidazo[4,5-b]pyridin-2-one
3-benzyl-1H-imidazo[4,5-b]pyridin-2-one (PubChem CID 910567) has the molecular formula C13H11N3O
and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-benzyl-1H-imidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 3-benzyl-1H-imidazo[4,5-b]pyridin-2-one |
| PubChem CID | 910567 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-benzyl-1H-imidazo[4,5-b]pyridin-2-one |
| SMILES | O=c1[nH]c2cccnc2n1Cc1ccccc1 |
| InChI | InChI=1S/C13H11N3O/c17-13-15-11-7-4-8-14-12(11)16(13)9-10-5-2-1-3-6-10/h1-8H,9H2,(H,15,17) |
| InChIKey | RJOUSKOGXRNRBW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzyl-1H-imidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1H-imidazo[4,5-b]pyridin-2-one?
The IUPAC name of 3-benzyl-1H-imidazo[4,5-b]pyridin-2-one (CID 910567) is 3-benzyl-1H-imidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 3-benzyl-1H-imidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 3-benzyl-1H-imidazo[4,5-b]pyridin-2-one is O=c1[nH]c2cccnc2n1Cc1ccccc1.
What is the InChIKey of 3-benzyl-1H-imidazo[4,5-b]pyridin-2-one?
The InChIKey is RJOUSKOGXRNRBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O/c17-13-15-11-7-4-8-14-12(11)16(13)9-10-5-2-1-3-6-10/h1-8H,9H2,(H,15,17).
What are the key properties of 3-benzyl-1H-imidazo[4,5-b]pyridin-2-one?
3-benzyl-1H-imidazo[4,5-b]pyridin-2-one has a molecular weight of 225.25 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1H-imidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 910567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).