C13H23N3O3S3 — CID 91056965
1-(2-methylsulfanylpropyl)-3,5-bis(2-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 91056965) has the molecular formula C13H23N3O3S3 and a molecular weight of 365.55 g/mol. Its IUPAC name is 1-(2-methylsulfanylpropyl)-3,5-bis(2-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(2-methylsulfanylpropyl)-3,5-bis(2-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 91056965 |
| Molecular Formula | C13H23N3O3S3 |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 1-(2-methylsulfanylpropyl)-3,5-bis(2-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CSC(C)Cn1c(=O)n(CC(C)S)c(=O)n(CC(C)S)c1=O |
| InChI | InChI=1S/C13H23N3O3S3/c1-8(20)5-14-11(17)15(6-9(2)21)13(19)16(12(14)18)7-10(3)22-4/h8-10,20-21H,5-7H2,1-4H3 |
| InChIKey | UFWMTGXXSFPZBS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|