C11H10N4O2 — CID 910570
3-amino-8-methyl-1,5-dihydropyrimido[5,4-b]indole-2,4-dione (PubChem CID 910570) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 3-amino-8-methyl-1,5-dihydropyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 3-amino-8-methyl-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 910570 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 3-amino-8-methyl-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| SMILES | Cc1ccc2[nH]c3c(=O)n(N)c(=O)[nH]c3c2c1 |
| InChI | InChI=1S/C11H10N4O2/c1-5-2-3-7-6(4-5)8-9(13-7)10(16)15(12)11(17)14-8/h2-4,13H,12H2,1H3,(H,14,17) |
| InChIKey | XCXHPWYYNHOFQS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |