About 9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine
9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine (PubChem CID 91057038) has the molecular formula C12H7F3N2O
and a molecular weight of 252.19 g/mol. Its IUPAC name is 9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine.
Molecular Properties
| Compound Name | 9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine |
| PubChem CID | 91057038 |
| Molecular Formula | C12H7F3N2O |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine |
| SMILES | FC(F)(F)c1ccnc2cc3c(cc12)N=CCO3 |
| InChI | InChI=1S/C12H7F3N2O/c13-12(14,15)8-1-2-16-9-6-11-10(5-7(8)9)17-3-4-18-11/h1-3,5-6H,4H2 |
| InChIKey | VSETYMPEUIKPAX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine?
The IUPAC name of 9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine (CID 91057038) is 9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine.
What is the SMILES notation for 9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine?
The canonical SMILES for 9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine is FC(F)(F)c1ccnc2cc3c(cc12)N=CCO3.
What is the InChIKey of 9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine?
The InChIKey is VSETYMPEUIKPAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F3N2O/c13-12(14,15)8-1-2-16-9-6-11-10(5-7(8)9)17-3-4-18-11/h1-3,5-6H,4H2.
What are the key properties of 9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine?
9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine has a molecular weight of 252.19 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(trifluoromethyl)-3H-pyrido[3,2-g][1,4]benzoxazine is sourced from PubChem (CID 91057038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).