About N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide
N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide (PubChem CID 91057374) has the molecular formula C22H38N2O3S
and a molecular weight of 410.62 g/mol. Its IUPAC name is N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide |
| PubChem CID | 91057374 |
| Molecular Formula | C22H38N2O3S |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide |
| SMILES | CCCCCCCCCn1c(O)cc(SCCNC(=O)C2CCCCC2)c1O |
| InChI | InChI=1S/C22H38N2O3S/c1-2-3-4-5-6-7-11-15-24-20(25)17-19(22(24)27)28-16-14-23-21(26)18-12-9-8-10-13-18/h17-18,25,27H,2-16H2,1H3,(H,23,26) |
| InChIKey | GJDUYJWRMBBJMF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide?
The IUPAC name of N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide (CID 91057374) is N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide.
What is the SMILES notation for N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide?
The canonical SMILES for N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide is CCCCCCCCCn1c(O)cc(SCCNC(=O)C2CCCCC2)c1O.
What is the InChIKey of N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide?
The InChIKey is GJDUYJWRMBBJMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38N2O3S/c1-2-3-4-5-6-7-11-15-24-20(25)17-19(22(24)27)28-16-14-23-21(26)18-12-9-8-10-13-18/h17-18,25,27H,2-16H2,1H3,(H,23,26).
What are the key properties of N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide?
N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide has a molecular weight of 410.62 g/mol, XLogP of 5.44, 13 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,5-dihydroxy-1-nonylpyrrol-3-yl)sulfanylethyl]cyclohexanecarboxamide is sourced from PubChem (CID 91057374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).